C18H32IN5O2S — CID 111238596
4-(2,3-dimethylphenyl)-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111238596) has the molecular formula C18H32IN5O2S and a molecular weight of 509.46 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111238596 |
| Molecular Formula | C18H32IN5O2S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C18H31N5O2S.HI/c1-15-7-5-8-17(16(15)2)22-11-13-23(14-12-22)18(19-3)20-9-6-10-21-26(4,24)25;/h5,7-8,21H,6,9-14H2,1-4H3,(H,19,20);1H |
| InChIKey | VJEQNYDIRORZGX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|