C17H29N5O3S — CID 111133421
N-[3-(methanesulfonamido)propyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111133421) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133421 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H29N5O3S/c1-18-17(19-9-6-10-20-26(3,23)24)22-13-11-21(12-14-22)15-7-4-5-8-16(15)25-2/h4-5,7-8,20H,6,9-14H2,1-3H3,(H,18,19) |
| InChIKey | HZBIVIHHUPEJOL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|