C16H23F3N4O — CID 111983705
4-(2-methoxyphenyl)-N'-methyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide (PubChem CID 111983705) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111983705 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C16H23F3N4O/c1-20-15(21-8-7-16(17,18)19)23-11-9-22(10-12-23)13-5-3-4-6-14(13)24-2/h3-6H,7-12H2,1-2H3,(H,20,21) |
| InChIKey | PNMAGSBRMYBCHZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|