C15H21F3N4 — CID 111546845
N'-methyl-4-phenyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide (PubChem CID 111546845) has the molecular formula C15H21F3N4 and a molecular weight of 314.36 g/mol. Its IUPAC name is N'-methyl-4-phenyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111546845 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N'-methyl-4-phenyl-N-(3,3,3-trifluoropropyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21F3N4/c1-19-14(20-8-7-15(16,17)18)22-11-9-21(10-12-22)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,19,20) |
| InChIKey | PPJLNWYJNNWLQF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|