C18H31N5O2S — CID 111546909
N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide (PubChem CID 111546909) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111546909 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H31N5O2S/c1-4-23(5-2)26(24,25)16-11-20-18(19-3)22-14-12-21(13-15-22)17-9-7-6-8-10-17/h6-10H,4-5,11-16H2,1-3H3,(H,19,20) |
| InChIKey | OGVHRUNIIMLZHN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|