C19H31F3IN5O2S — CID 111234166
N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111234166) has the molecular formula C19H31F3IN5O2S and a molecular weight of 577.46 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111234166 |
| Molecular Formula | C19H31F3IN5O2S |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-N'-methyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CCCN/C(=N\C)N1CCN(c2cccc(C(F)(F)F)c2)CC1)S(C)(=O)=O.I |
| InChI | InChI=1S/C19H30F3N5O2S.HI/c1-4-27(30(3,28)29)10-6-9-24-18(23-2)26-13-11-25(12-14-26)17-8-5-7-16(15-17)19(20,21)22;/h5,7-8,15H,4,6,9-14H2,1-3H3,(H,23,24);1H |
| InChIKey | ZTXWUFNGSDNCCG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|