C23H29F3IN5O — CID 111233902
N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide (PubChem CID 111233902) has the molecular formula C23H29F3IN5O and a molecular weight of 575.42 g/mol. Its IUPAC name is N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111233902 |
| Molecular Formula | C23H29F3IN5O |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(NC(C)=O)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C23H28F3N5O.HI/c1-17(32)29-20-8-6-18(7-9-20)10-11-28-22(27-2)31-14-12-30(13-15-31)21-5-3-4-19(16-21)23(24,25)26;/h3-9,16H,10-15H2,1-2H3,(H,27,28)(H,29,32);1H |
| InChIKey | JERROXBFOKMKRK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|