C23H28F3N5O — CID 111233903
N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide (PubChem CID 111233903) has the molecular formula C23H28F3N5O and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111233903 |
| Molecular Formula | C23H28F3N5O |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[4-[2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]ethyl]phenyl]acetamide |
| SMILES | C/N=C(\NCCc1ccc(NC(C)=O)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H28F3N5O/c1-17(32)29-20-8-6-18(7-9-20)10-11-28-22(27-2)31-14-12-30(13-15-31)21-5-3-4-19(16-21)23(24,25)26/h3-9,16H,10-15H2,1-2H3,(H,27,28)(H,29,32) |
| InChIKey | CLQZPGLMZSCVOD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|