C23H29F3IN5O — CID 111234104
N,N-dimethyl-4-[[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111234104) has the molecular formula C23H29F3IN5O and a molecular weight of 575.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111234104 |
| Molecular Formula | C23H29F3IN5O |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N,N-dimethyl-4-[[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C23H28F3N5O.HI/c1-27-22(28-16-17-7-9-18(10-8-17)21(32)29(2)3)31-13-11-30(12-14-31)20-6-4-5-19(15-20)23(24,25)26;/h4-10,15H,11-14,16H2,1-3H3,(H,27,28);1H |
| InChIKey | RZLLBVRBNUNQBN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|