C18H24F6IN5O — CID 111500512
N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111500512) has the molecular formula C18H24F6IN5O and a molecular weight of 567.32 g/mol. Its IUPAC name is N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111500512 |
| Molecular Formula | C18H24F6IN5O |
| Molecular Weight | 567.32 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N1CCN(c2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C18H23F6N5O.HI/c1-25-16(26-11-15(30)27(2)12-17(19,20)21)29-8-6-28(7-9-29)14-5-3-4-13(10-14)18(22,23)24;/h3-5,10H,6-9,11-12H2,1-2H3,(H,25,26);1H |
| InChIKey | JZRMLNADXCNHSZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|