C16H22F3N5O — CID 119131012
N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]acetamide (PubChem CID 119131012) has the molecular formula C16H22F3N5O and a molecular weight of 357.38 g/mol. Its IUPAC name is N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]acetamide.
| Compound Name | N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 119131012 |
| Molecular Formula | C16H22F3N5O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-methyl-2-[[N-methyl-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F3N5O/c1-20-14(25)11-22-15(21-2)24-8-6-23(7-9-24)13-5-3-4-12(10-13)16(17,18)19/h3-5,10H,6-9,11H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | FQUPIXLMNLWBBX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|