C9H16F3N3 — CID 111466142
N'-methyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide (PubChem CID 111466142) has the molecular formula C9H16F3N3 and a molecular weight of 223.24 g/mol. Its IUPAC name is N'-methyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111466142 |
| Molecular Formula | C9H16F3N3 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N'-methyl-N-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C9H16F3N3/c1-13-8(15-6-2-3-7-15)14-5-4-9(10,11)12/h2-7H2,1H3,(H,13,14) |
| InChIKey | UZQMJECHVAAFRI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|