C16H26ClIN4O2S — CID 111177333
4-(2-chlorophenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111177333) has the molecular formula C16H26ClIN4O2S and a molecular weight of 500.83 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-chlorophenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111177333 |
| Molecular Formula | C16H26ClIN4O2S |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 4-(2-chlorophenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)N1CCN(c2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C16H25ClN4O2S.HI/c1-18-16(19-8-5-13-24(2,22)23)21-11-9-20(10-12-21)15-7-4-3-6-14(15)17;/h3-4,6-7H,5,8-13H2,1-2H3,(H,18,19);1H |
| InChIKey | MGMFYTTXQNEKBQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|