C17H28ClIN4O2S — CID 111264270
4-(5-chloro-2-methylphenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111264270) has the molecular formula C17H28ClIN4O2S and a molecular weight of 514.86 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264270 |
| Molecular Formula | C17H28ClIN4O2S |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(3-methylsulfonylpropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCS(C)(=O)=O)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C17H27ClN4O2S.HI/c1-14-5-6-15(18)13-16(14)21-8-10-22(11-9-21)17(19-2)20-7-4-12-25(3,23)24;/h5-6,13H,4,7-12H2,1-3H3,(H,19,20);1H |
| InChIKey | VHHUHRPZNBIFDQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|