C13H20ClIN4 — CID 111264276
4-(5-chloro-2-methylphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111264276) has the molecular formula C13H20ClIN4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264276 |
| Molecular Formula | C13H20ClIN4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\N)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C13H19ClN4.HI/c1-10-3-4-11(14)9-12(10)17-5-7-18(8-6-17)13(15)16-2;/h3-4,9H,5-8H2,1-2H3,(H2,15,16);1H |
| InChIKey | CGKJYGAKXYRWCO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|