C12H17F2IN4 — CID 109451122
4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109451122) has the molecular formula C12H17F2IN4 and a molecular weight of 382.20 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109451122 |
| Molecular Formula | C12H17F2IN4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\N)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C12H16F2N4.HI/c1-16-12(15)18-6-4-17(5-7-18)11-8-9(13)2-3-10(11)14;/h2-3,8H,4-7H2,1H3,(H2,15,16);1H |
| InChIKey | ZXKINVOITJLUJS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|