C15H22F2N4 — CID 75469826
4-[1-(2,4-difluorophenyl)propyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 75469826) has the molecular formula C15H22F2N4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[1-(2,4-difluorophenyl)propyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[1-(2,4-difluorophenyl)propyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 75469826 |
| Molecular Formula | C15H22F2N4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 4-[1-(2,4-difluorophenyl)propyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCC(c1ccc(F)cc1F)N1CCN(/C(N)=N/C)CC1 |
| InChI | InChI=1S/C15H22F2N4/c1-3-14(12-5-4-11(16)10-13(12)17)20-6-8-21(9-7-20)15(18)19-2/h4-5,10,14H,3,6-9H2,1-2H3,(H2,18,19) |
| InChIKey | GZQPGJKTUJNADD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|