C18H25F2N3O2 — CID 119894372
[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]-morpholin-3-ylmethanone (PubChem CID 119894372) has the molecular formula C18H25F2N3O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is [4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]-morpholin-3-ylmethanone.
| Compound Name | [4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]-morpholin-3-ylmethanone |
|---|---|
| PubChem CID | 119894372 |
| Molecular Formula | C18H25F2N3O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | [4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]-morpholin-3-ylmethanone |
| SMILES | CCC(c1ccc(F)cc1F)N1CCN(C(=O)C2COCCN2)CC1 |
| InChI | InChI=1S/C18H25F2N3O2/c1-2-17(14-4-3-13(19)11-15(14)20)22-6-8-23(9-7-22)18(24)16-12-25-10-5-21-16/h3-4,11,16-17,21H,2,5-10,12H2,1H3 |
| InChIKey | IOWSBRFJTGLYQQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |