C20H25Cl2F2N3O — CID 119894401
(3-aminophenyl)-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119894401) has the molecular formula C20H25Cl2F2N3O and a molecular weight of 432.34 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119894401 |
| Molecular Formula | C20H25Cl2F2N3O |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3-aminophenyl)-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CCC(c1ccc(F)cc1F)N1CCN(C(=O)c2cccc(N)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H23F2N3O.2ClH/c1-2-19(17-7-6-15(21)13-18(17)22)24-8-10-25(11-9-24)20(26)14-4-3-5-16(23)12-14;;/h3-7,12-13,19H,2,8-11,23H2,1H3;2*1H |
| InChIKey | YUJBSCWPQHBULT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|