C14H21F2N3 — CID 16791134
2-(2,4-difluorophenyl)-2-(4-ethylpiperazin-1-yl)ethanamine (PubChem CID 16791134) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-(4-ethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-2-(4-ethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 16791134 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-(4-ethylpiperazin-1-yl)ethanamine |
| SMILES | CCN1CCN(C(CN)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H21F2N3/c1-2-18-5-7-19(8-6-18)14(10-17)12-4-3-11(15)9-13(12)16/h3-4,9,14H,2,5-8,10,17H2,1H3 |
| InChIKey | RPICFRAZJBJRIL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |