C12H17ClF2N2O — CID 46736564
2-(2,4-difluorophenyl)-2-morpholin-4-ylethanamine;hydrochloride (PubChem CID 46736564) has the molecular formula C12H17ClF2N2O and a molecular weight of 278.73 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-morpholin-4-ylethanamine;hydrochloride.
| Compound Name | 2-(2,4-difluorophenyl)-2-morpholin-4-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 46736564 |
| Molecular Formula | C12H17ClF2N2O |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-morpholin-4-ylethanamine;hydrochloride |
| SMILES | Cl.NCC(c1ccc(F)cc1F)N1CCOCC1 |
| InChI | InChI=1S/C12H16F2N2O.ClH/c13-9-1-2-10(11(14)7-9)12(8-15)16-3-5-17-6-4-16;/h1-2,7,12H,3-6,8,15H2;1H |
| InChIKey | UWNBVJPWZVWYLA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |