C17H28ClN5O2S — CID 111264391
4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[2-(methanesulfonamido)ethyl]piperazine-1-carboximidamide (PubChem CID 111264391) has the molecular formula C17H28ClN5O2S and a molecular weight of 401.96 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[2-(methanesulfonamido)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[2-(methanesulfonamido)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264391 |
| Molecular Formula | C17H28ClN5O2S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[2-(methanesulfonamido)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C17H28ClN5O2S/c1-4-19-17(20-7-8-21-26(3,24)25)23-11-9-22(10-12-23)16-13-15(18)6-5-14(16)2/h5-6,13,21H,4,7-12H2,1-3H3,(H,19,20) |
| InChIKey | IACHHGMZXGBIRO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|