C23H32ClN5O — CID 111264309
4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide (PubChem CID 111264309) has the molecular formula C23H32ClN5O and a molecular weight of 430.00 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264309 |
| Molecular Formula | C23H32ClN5O |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1ccccc1=O)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C23H32ClN5O/c1-3-25-23(26-11-5-7-13-28-12-6-4-8-22(28)30)29-16-14-27(15-17-29)21-18-20(24)10-9-19(21)2/h4,6,8-10,12,18H,3,5,7,11,13-17H2,1-2H3,(H,25,26) |
| InChIKey | LFCWDEAAAVBHHR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|