C22H32IN5O — CID 110960898
N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110960898) has the molecular formula C22H32IN5O and a molecular weight of 509.44 g/mol. Its IUPAC name is N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110960898 |
| Molecular Formula | C22H32IN5O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCn1ccccc1=O)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H31N5O.HI/c1-2-23-22(24-13-7-9-15-26-14-8-6-12-21(26)28)27-18-16-25(17-19-27)20-10-4-3-5-11-20;/h3-6,8,10-12,14H,2,7,9,13,15-19H2,1H3,(H,23,24);1H |
| InChIKey | DFIOLMROHWKZHG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|