C22H29F2N5O — CID 109450555
4-(2,5-difluorophenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide (PubChem CID 109450555) has the molecular formula C22H29F2N5O and a molecular weight of 417.50 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450555 |
| Molecular Formula | C22H29F2N5O |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1ccccc1=O)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H29F2N5O/c1-2-25-22(26-10-4-6-12-28-11-5-3-7-21(28)30)29-15-13-27(14-16-29)20-17-18(23)8-9-19(20)24/h3,5,7-9,11,17H,2,4,6,10,12-16H2,1H3,(H,25,26) |
| InChIKey | GIEHTBRSURGSPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|