C18H29N5O2 — CID 110962613
4-acetyl-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide (PubChem CID 110962613) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962613 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCn1ccccc1=O)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H29N5O2/c1-3-19-18(23-14-12-21(13-15-23)16(2)24)20-9-5-7-11-22-10-6-4-8-17(22)25/h4,6,8,10H,3,5,7,9,11-15H2,1-2H3,(H,19,20) |
| InChIKey | CUVKTSQAKSSSRC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|