C19H32IN5O3 — CID 111164792
ethyl 4-[N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164792) has the molecular formula C19H32IN5O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164792 |
| Molecular Formula | C19H32IN5O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[4-(2-oxo-1-pyridinyl)butyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCCn1ccccc1=O)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H31N5O3.HI/c1-3-20-18(23-13-15-24(16-14-23)19(26)27-4-2)21-10-6-8-12-22-11-7-5-9-17(22)25;/h5,7,9,11H,3-4,6,8,10,12-16H2,1-2H3,(H,20,21);1H |
| InChIKey | SLPYXUAZLDNHGO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|