C19H28N6O — CID 110963601
4-acetyl-N'-[3-(benzimidazol-1-yl)propyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110963601) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-acetyl-N'-[3-(benzimidazol-1-yl)propyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[3-(benzimidazol-1-yl)propyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963601 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 4-acetyl-N'-[3-(benzimidazol-1-yl)propyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCn1cnc2ccccc21)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H28N6O/c1-3-20-19(24-13-11-23(12-14-24)16(2)26)21-9-6-10-25-15-22-17-7-4-5-8-18(17)25/h4-5,7-8,15H,3,6,9-14H2,1-2H3,(H,20,21) |
| InChIKey | JCCTVCPRQHHLML-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|