C15H27IN6O — CID 110963148
4-acetyl-N-ethyl-N'-(3-imidazol-1-ylpropyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110963148) has the molecular formula C15H27IN6O and a molecular weight of 434.33 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-(3-imidazol-1-ylpropyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N-ethyl-N'-(3-imidazol-1-ylpropyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110963148 |
| Molecular Formula | C15H27IN6O |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-(3-imidazol-1-ylpropyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCn1ccnc1)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C15H26N6O.HI/c1-3-17-15(18-5-4-7-19-8-6-16-13-19)21-11-9-20(10-12-21)14(2)22;/h6,8,13H,3-5,7,9-12H2,1-2H3,(H,17,18);1H |
| InChIKey | GIOPVASRDOUBNE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|