C12H21N5O — CID 111550250
(3R)-N-ethyl-3-hydroxy-N'-(2-imidazol-1-ylethyl)pyrrolidine-1-carboximidamide (PubChem CID 111550250) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-(2-imidazol-1-ylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-(2-imidazol-1-ylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111550250 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-(2-imidazol-1-ylethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCn1ccnc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H21N5O/c1-2-14-12(17-6-3-11(18)9-17)15-5-8-16-7-4-13-10-16/h4,7,10-11,18H,2-3,5-6,8-9H2,1H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | DBNKBOCQMKXQTH-LLVKDONJSA-N |
| XLogP | -0.08 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|