C13H23N5 — CID 110991931
1-cyclopentyl-3-ethyl-2-(2-imidazol-1-ylethyl)guanidine (PubChem CID 110991931) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-cyclopentyl-3-ethyl-2-(2-imidazol-1-ylethyl)guanidine.
| Compound Name | 1-cyclopentyl-3-ethyl-2-(2-imidazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 110991931 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-cyclopentyl-3-ethyl-2-(2-imidazol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCn1ccnc1)NC1CCCC1 |
| InChI | InChI=1S/C13H23N5/c1-2-15-13(17-12-5-3-4-6-12)16-8-10-18-9-7-14-11-18/h7,9,11-12H,2-6,8,10H2,1H3,(H2,15,16,17) |
| InChIKey | HZWUBCFTXOGFDJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|