C9H15N5 — CID 62362892
1-cyclopropyl-2-(2-imidazol-1-ylethyl)guanidine (PubChem CID 62362892) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-imidazol-1-ylethyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(2-imidazol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 62362892 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-cyclopropyl-2-(2-imidazol-1-ylethyl)guanidine |
| SMILES | N/C(=N\CCn1ccnc1)NC1CC1 |
| InChI | InChI=1S/C9H15N5/c10-9(13-8-1-2-8)12-4-6-14-5-3-11-7-14/h3,5,7-8H,1-2,4,6H2,(H3,10,12,13) |
| InChIKey | JPWAKGWSKRDGTJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|