C10H19N5O — CID 111030816
2-(2-imidazol-1-ylethyl)-1-(1-methoxypropan-2-yl)guanidine (PubChem CID 111030816) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-(2-imidazol-1-ylethyl)-1-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-(2-imidazol-1-ylethyl)-1-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111030816 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-(2-imidazol-1-ylethyl)-1-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(N)=N/CCn1ccnc1 |
| InChI | InChI=1S/C10H19N5O/c1-9(7-16-2)14-10(11)13-4-6-15-5-3-12-8-15/h3,5,8-9H,4,6-7H2,1-2H3,(H3,11,13,14) |
| InChIKey | KPNWWHIPTOOOLE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|