C11H20N4OS — CID 40519952
1-(3-imidazol-1-ylpropyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 40519952) has the molecular formula C11H20N4OS and a molecular weight of 256.38 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 40519952 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)NCCCn1ccnc1 |
| InChI | InChI=1S/C11H20N4OS/c1-10(8-16-2)14-11(17)13-4-3-6-15-7-5-12-9-15/h5,7,9-10H,3-4,6,8H2,1-2H3,(H2,13,14,17)/t10-/m0/s1 |
| InChIKey | MUXMSUVJGMHVQQ-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|