C10H22N2O2S — CID 104587643
1-(1-methoxypropan-2-yl)-3-(2-propan-2-yloxyethyl)thiourea (PubChem CID 104587643) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-(2-propan-2-yloxyethyl)thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-(2-propan-2-yloxyethyl)thiourea |
|---|---|
| PubChem CID | 104587643 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-(2-propan-2-yloxyethyl)thiourea |
| SMILES | COCC(C)NC(=S)NCCOC(C)C |
| InChI | InChI=1S/C10H22N2O2S/c1-8(2)14-6-5-11-10(15)12-9(3)7-13-4/h8-9H,5-7H2,1-4H3,(H2,11,12,15) |
| InChIKey | IQYLMKOIXHBZSZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|