C10H21N3O3S — CID 115573844
N-(2-methoxyethyl)-2-(1-methoxypropan-2-ylcarbamothioylamino)acetamide (PubChem CID 115573844) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1-methoxypropan-2-ylcarbamothioylamino)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(1-methoxypropan-2-ylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 115573844 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1-methoxypropan-2-ylcarbamothioylamino)acetamide |
| SMILES | COCCNC(=O)CNC(=S)NC(C)COC |
| InChI | InChI=1S/C10H21N3O3S/c1-8(7-16-3)13-10(17)12-6-9(14)11-4-5-15-2/h8H,4-7H2,1-3H3,(H,11,14)(H2,12,13,17) |
| InChIKey | WCSBIGCYIFEWST-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|