About 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea
1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 115642333) has the molecular formula C11H24N2OS
and a molecular weight of 232.39 g/mol. Its IUPAC name is 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea |
| PubChem CID | 115642333 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | COCC(C)NC(=S)NCC(C)C(C)C |
| InChI | InChI=1S/C11H24N2OS/c1-8(2)9(3)6-12-11(15)13-10(4)7-14-5/h8-10H,6-7H2,1-5H3,(H2,12,13,15) |
| InChIKey | GIEYLWIFYDTOOC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea?
The IUPAC name of 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea (CID 115642333) is 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea.
What is the SMILES notation for 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea?
The canonical SMILES for 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea is COCC(C)NC(=S)NCC(C)C(C)C.
What is the InChIKey of 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea?
The InChIKey is GIEYLWIFYDTOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2OS/c1-8(2)9(3)6-12-11(15)13-10(4)7-14-5/h8-10H,6-7H2,1-5H3,(H2,12,13,15).
What are the key properties of 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea?
1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea has a molecular weight of 232.39 g/mol, XLogP of 1.78, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylbutyl)-3-(1-methoxypropan-2-yl)thiourea is sourced from PubChem (CID 115642333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).