C10H22N2OS — CID 115642325
1-(2,3-dimethylbutyl)-3-(2-methoxyethyl)thiourea (PubChem CID 115642325) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-(2,3-dimethylbutyl)-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-(2,3-dimethylbutyl)-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 115642325 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(2,3-dimethylbutyl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCC(C)C(C)C |
| InChI | InChI=1S/C10H22N2OS/c1-8(2)9(3)7-12-10(14)11-5-6-13-4/h8-9H,5-7H2,1-4H3,(H2,11,12,14) |
| InChIKey | XCMNUOKJZJFELM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|