C7H14F2N2OS — CID 115667334
1-(2,2-difluoroethyl)-3-(3-methoxypropyl)thiourea (PubChem CID 115667334) has the molecular formula C7H14F2N2OS and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-(2,2-difluoroethyl)-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 115667334 |
| Molecular Formula | C7H14F2N2OS |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NCC(F)F |
| InChI | InChI=1S/C7H14F2N2OS/c1-12-4-2-3-10-7(13)11-5-6(8)9/h6H,2-5H2,1H3,(H2,10,11,13) |
| InChIKey | SBNQLEPABITMDT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|