C7H15N3O2S — CID 115605893
2-(3-methoxypropylcarbamothioylamino)acetamide (PubChem CID 115605893) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-(3-methoxypropylcarbamothioylamino)acetamide.
| Compound Name | 2-(3-methoxypropylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 115605893 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(3-methoxypropylcarbamothioylamino)acetamide |
| SMILES | COCCCNC(=S)NCC(N)=O |
| InChI | InChI=1S/C7H15N3O2S/c1-12-4-2-3-9-7(13)10-5-6(8)11/h2-5H2,1H3,(H2,8,11)(H2,9,10,13) |
| InChIKey | DADSKQOOXBDZGH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|