About carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate
carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate (PubChem CID 88720179) has the molecular formula C7H16N2O3S2
and a molecular weight of 240.35 g/mol. Its IUPAC name is carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate |
| PubChem CID | 88720179 |
| Molecular Formula | C7H16N2O3S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate |
| SMILES | COCCCNC(=S)OC.NC(=O)S |
| InChI | InChI=1S/C6H13NO2S.CH3NOS/c1-8-5-3-4-7-6(10)9-2;2-1(3)4/h3-5H2,1-2H3,(H,7,10);(H3,2,3,4) |
| InChIKey | UKIMZEYVLGQDEU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate?
The IUPAC name of carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate (CID 88720179) is carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate?
The canonical SMILES for carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate is COCCCNC(=S)OC.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate?
The InChIKey is UKIMZEYVLGQDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2S.CH3NOS/c1-8-5-3-4-7-6(10)9-2;2-1(3)4/h3-5H2,1-2H3,(H,7,10);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate?
carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate has a molecular weight of 240.35 g/mol, XLogP of 0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-methyl N-(3-methoxypropyl)carbamothioate is sourced from PubChem (CID 88720179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).