C9H19N3O4 — CID 112673851
2-[(2-amino-2-oxoethoxy)amino]-N-(3-methoxypropyl)propanamide (PubChem CID 112673851) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethoxy)amino]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[(2-amino-2-oxoethoxy)amino]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 112673851 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[(2-amino-2-oxoethoxy)amino]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)NOCC(N)=O |
| InChI | InChI=1S/C9H19N3O4/c1-7(12-16-6-8(10)13)9(14)11-4-3-5-15-2/h7,12H,3-6H2,1-2H3,(H2,10,13)(H,11,14) |
| InChIKey | CPFLASOUJMXLEK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|