C12H27N3O2 — CID 82937481
2-[1-(dimethylamino)propan-2-ylamino]-N-(3-methoxypropyl)propanamide (PubChem CID 82937481) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-[1-(dimethylamino)propan-2-ylamino]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[1-(dimethylamino)propan-2-ylamino]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 82937481 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-[1-(dimethylamino)propan-2-ylamino]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)NC(C)CN(C)C |
| InChI | InChI=1S/C12H27N3O2/c1-10(9-15(3)4)14-11(2)12(16)13-7-6-8-17-5/h10-11,14H,6-9H2,1-5H3,(H,13,16) |
| InChIKey | OQYIKLNECWPGKY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|