About 3-methoxypropylurea
3-methoxypropylurea (PubChem CID 2064040) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-methoxypropylurea.
Molecular Properties
| Compound Name | 3-methoxypropylurea |
| PubChem CID | 2064040 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 3-methoxypropylurea |
| SMILES | COCCCNC(N)=O |
| InChI | InChI=1S/C5H12N2O2/c1-9-4-2-3-7-5(6)8/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | SJCBTGYXKOFNHX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropylurea?
The IUPAC name of 3-methoxypropylurea (CID 2064040) is 3-methoxypropylurea.
What is the SMILES notation for 3-methoxypropylurea?
The canonical SMILES for 3-methoxypropylurea is COCCCNC(N)=O.
What is the InChIKey of 3-methoxypropylurea?
The InChIKey is SJCBTGYXKOFNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-9-4-2-3-7-5(6)8/h2-4H2,1H3,(H3,6,7,8).
What are the key properties of 3-methoxypropylurea?
3-methoxypropylurea has a molecular weight of 132.16 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropylurea is sourced from PubChem (CID 2064040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).