About 3-butoxypropylurea
3-butoxypropylurea (PubChem CID 115575573) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-butoxypropylurea.
Molecular Properties
| Compound Name | 3-butoxypropylurea |
| PubChem CID | 115575573 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-butoxypropylurea |
| SMILES | CCCCOCCCNC(N)=O |
| InChI | InChI=1S/C8H18N2O2/c1-2-3-6-12-7-4-5-10-8(9)11/h2-7H2,1H3,(H3,9,10,11) |
| InChIKey | AAMFCIXUZSOJHQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxypropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxypropylurea?
The IUPAC name of 3-butoxypropylurea (CID 115575573) is 3-butoxypropylurea.
What is the SMILES notation for 3-butoxypropylurea?
The canonical SMILES for 3-butoxypropylurea is CCCCOCCCNC(N)=O.
What is the InChIKey of 3-butoxypropylurea?
The InChIKey is AAMFCIXUZSOJHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-2-3-6-12-7-4-5-10-8(9)11/h2-7H2,1H3,(H3,9,10,11).
What are the key properties of 3-butoxypropylurea?
3-butoxypropylurea has a molecular weight of 174.24 g/mol, XLogP of 0.86, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxypropylurea is sourced from PubChem (CID 115575573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).