C12H29N3O3S2 — CID 87956666
carbamothioic S-acid;N,N-diethylethanamine;3-methoxypropylcarbamothioic S-acid (PubChem CID 87956666) has the molecular formula C12H29N3O3S2 and a molecular weight of 327.52 g/mol. Its IUPAC name is carbamothioic S-acid;N,N-diethylethanamine;3-methoxypropylcarbamothioic S-acid.
| Compound Name | carbamothioic S-acid;N,N-diethylethanamine;3-methoxypropylcarbamothioic S-acid |
|---|---|
| PubChem CID | 87956666 |
| Molecular Formula | C12H29N3O3S2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | carbamothioic S-acid;N,N-diethylethanamine;3-methoxypropylcarbamothioic S-acid |
| SMILES | CCN(CC)CC.COCCCNC(=O)S.NC(=O)S |
| InChI | InChI=1S/C6H15N.C5H11NO2S.CH3NOS/c1-4-7(5-2)6-3;1-8-4-2-3-6-5(7)9;2-1(3)4/h4-6H2,1-3H3;2-4H2,1H3,(H2,6,7,9);(H3,2,3,4) |
| InChIKey | HHPVPDPLVBBXPK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|