C11H25N3O4S2 — CID 87956229
carbamothioic S-acid;N,N-diethylethanamine;(2-methoxy-2-oxoethyl)carbamothioic S-acid (PubChem CID 87956229) has the molecular formula C11H25N3O4S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is carbamothioic S-acid;N,N-diethylethanamine;(2-methoxy-2-oxoethyl)carbamothioic S-acid.
| Compound Name | carbamothioic S-acid;N,N-diethylethanamine;(2-methoxy-2-oxoethyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 87956229 |
| Molecular Formula | C11H25N3O4S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | carbamothioic S-acid;N,N-diethylethanamine;(2-methoxy-2-oxoethyl)carbamothioic S-acid |
| SMILES | CCN(CC)CC.COC(=O)CNC(=O)S.NC(=O)S |
| InChI | InChI=1S/C6H15N.C4H7NO3S.CH3NOS/c1-4-7(5-2)6-3;1-8-3(6)2-5-4(7)9;2-1(3)4/h4-6H2,1-3H3;2H2,1H3,(H2,5,7,9);(H3,2,3,4) |
| InChIKey | DDXDODWPEXFGKV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|