C7H11N3O4S — CID 43316324
methyl 2-[[2-[(2-amino-2-sulfanylideneethyl)amino]-2-oxoacetyl]amino]acetate (PubChem CID 43316324) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is methyl 2-[[2-[(2-amino-2-sulfanylideneethyl)amino]-2-oxoacetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[(2-amino-2-sulfanylideneethyl)amino]-2-oxoacetyl]amino]acetate |
|---|---|
| PubChem CID | 43316324 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 2-[[2-[(2-amino-2-sulfanylideneethyl)amino]-2-oxoacetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C7H11N3O4S/c1-14-5(11)3-10-7(13)6(12)9-2-4(8)15/h2-3H2,1H3,(H2,8,15)(H,9,12)(H,10,13) |
| InChIKey | IPDYWWOVTITWFF-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|