C6H8F3N3O2S — CID 43316392
N-(2-amino-2-sulfanylideneethyl)-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 43316392) has the molecular formula C6H8F3N3O2S and a molecular weight of 243.21 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 43316392 |
| Molecular Formula | C6H8F3N3O2S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O2S/c7-6(8,9)2-12-5(14)4(13)11-1-3(10)15/h1-2H2,(H2,10,15)(H,11,13)(H,12,14) |
| InChIKey | DSPXEXWBLDWLAG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|