C7H11F3N2O2S — CID 103208314
N-(2-amino-2-sulfanylideneethyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103208314) has the molecular formula C7H11F3N2O2S and a molecular weight of 244.24 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103208314 |
| Molecular Formula | C7H11F3N2O2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | NC(=S)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S/c8-7(9,10)4-14-2-1-6(13)12-3-5(11)15/h1-4H2,(H2,11,15)(H,12,13) |
| InChIKey | SPLGYPPHHIIEBX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|